C14H13ClN2OS — CID 110715860
2-chloro-N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)benzamide (PubChem CID 110715860) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 110715860 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-chloro-N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccccc1Cl)N(Cc1nccs1)C1CC1 |
| InChI | InChI=1S/C14H13ClN2OS/c15-12-4-2-1-3-11(12)14(18)17(10-5-6-10)9-13-16-7-8-19-13/h1-4,7-8,10H,5-6,9H2 |
| InChIKey | AUKRPHTXYJEZKU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |