C18H16ClNO3 — CID 42724637
N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-cyclopropylbenzamide (PubChem CID 42724637) has the molecular formula C18H16ClNO3 and a molecular weight of 329.78 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-cyclopropylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 42724637 |
| Molecular Formula | C18H16ClNO3 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-cyclopropylbenzamide |
| SMILES | O=C(c1ccccc1Cl)N(Cc1ccc2c(c1)OCO2)C1CC1 |
| InChI | InChI=1S/C18H16ClNO3/c19-15-4-2-1-3-14(15)18(21)20(13-6-7-13)10-12-5-8-16-17(9-12)23-11-22-16/h1-5,8-9,13H,6-7,10-11H2 |
| InChIKey | JTBVEHYBKNCJRH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |