C23H18ClNO5 — CID 42776726
N,N-bis(1,3-benzodioxol-5-ylmethyl)-2-chlorobenzamide (PubChem CID 42776726) has the molecular formula C23H18ClNO5 and a molecular weight of 423.85 g/mol. Its IUPAC name is N,N-bis(1,3-benzodioxol-5-ylmethyl)-2-chlorobenzamide.
| Compound Name | N,N-bis(1,3-benzodioxol-5-ylmethyl)-2-chlorobenzamide |
|---|---|
| PubChem CID | 42776726 |
| Molecular Formula | C23H18ClNO5 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N,N-bis(1,3-benzodioxol-5-ylmethyl)-2-chlorobenzamide |
| SMILES | O=C(c1ccccc1Cl)N(Cc1ccc2c(c1)OCO2)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H18ClNO5/c24-18-4-2-1-3-17(18)23(26)25(11-15-5-7-19-21(9-15)29-13-27-19)12-16-6-8-20-22(10-16)30-14-28-20/h1-10H,11-14H2 |
| InChIKey | XWZDBEQHKNOWNC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |