C22H25NO3 — CID 42723771
N-(1,3-benzodioxol-5-ylmethyl)-4-butyl-N-cyclopropylbenzamide (PubChem CID 42723771) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-butyl-N-cyclopropylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-butyl-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 42723771 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-butyl-N-cyclopropylbenzamide |
| SMILES | CCCCc1ccc(C(=O)N(Cc2ccc3c(c2)OCO3)C2CC2)cc1 |
| InChI | InChI=1S/C22H25NO3/c1-2-3-4-16-5-8-18(9-6-16)22(24)23(19-10-11-19)14-17-7-12-20-21(13-17)26-15-25-20/h5-9,12-13,19H,2-4,10-11,14-15H2,1H3 |
| InChIKey | BBCXRQJNLGIBAX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |