C27H36N2O4 — CID 42725267
N-(1,3-benzodioxol-5-ylmethyl)-N-(3-morpholin-4-ylpropyl)-4-pentylbenzamide (PubChem CID 42725267) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-(3-morpholin-4-ylpropyl)-4-pentylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-(3-morpholin-4-ylpropyl)-4-pentylbenzamide |
|---|---|
| PubChem CID | 42725267 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-(3-morpholin-4-ylpropyl)-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)N(CCCN2CCOCC2)Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C27H36N2O4/c1-2-3-4-6-22-7-10-24(11-8-22)27(30)29(14-5-13-28-15-17-31-18-16-28)20-23-9-12-25-26(19-23)33-21-32-25/h7-12,19H,2-6,13-18,20-21H2,1H3 |
| InChIKey | WGPGGHSJQYYCNV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|