C34H43N3O6 — CID 5244811
N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-4-pentylbenzamide (PubChem CID 5244811) has the molecular formula C34H43N3O6 and a molecular weight of 589.73 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-4-pentylbenzamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-4-pentylbenzamide |
|---|---|
| PubChem CID | 5244811 |
| Molecular Formula | C34H43N3O6 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.32 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)N(CCCN2CCOCC2)CC(=O)N(Cc2ccc3c(c2)OCO3)Cc2ccco2)cc1 |
| InChI | InChI=1S/C34H43N3O6/c1-2-3-4-7-27-9-12-29(13-10-27)34(39)36(16-6-15-35-17-20-40-21-18-35)25-33(38)37(24-30-8-5-19-41-30)23-28-11-14-31-32(22-28)43-26-42-31/h5,8-14,19,22H,2-4,6-7,15-18,20-21,23-26H2,1H3 |
| InChIKey | VXJPERWWXPQGCN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 84.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|