C32H41N3O5 — CID 4098227
N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-butoxy-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 4098227) has the molecular formula C32H41N3O5 and a molecular weight of 547.70 g/mol. Its IUPAC name is N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-butoxy-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-butoxy-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 4098227 |
| Molecular Formula | C32H41N3O5 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.30 |
| IUPAC Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-butoxy-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCCN2CCOCC2)CC(=O)N(Cc2ccccc2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C32H41N3O5/c1-2-3-20-39-29-14-12-28(13-15-29)32(37)34(17-8-16-33-18-22-38-23-19-33)26-31(36)35(25-30-11-7-21-40-30)24-27-9-5-4-6-10-27/h4-7,9-15,21H,2-3,8,16-20,22-26H2,1H3 |
| InChIKey | MNAQMGVTRCYIIP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|