C28H32N2O4 — CID 5136606
N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-butoxy-N-prop-2-enylbenzamide (PubChem CID 5136606) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-butoxy-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-butoxy-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 5136606 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-butoxy-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1ccco1)C(=O)c1ccc(OCCCC)cc1 |
| InChI | InChI=1S/C28H32N2O4/c1-3-5-18-33-25-15-13-24(14-16-25)28(32)29(17-4-2)22-27(31)30(21-26-12-9-19-34-26)20-23-10-7-6-8-11-23/h4,6-16,19H,2-3,5,17-18,20-22H2,1H3 |
| InChIKey | BICGGNCVSVKABM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|