C31H40N2O4 — CID 3896391
N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-hexyl-N-(3-methoxypropyl)benzamide (PubChem CID 3896391) has the molecular formula C31H40N2O4 and a molecular weight of 504.67 g/mol. Its IUPAC name is N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-hexyl-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-hexyl-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 3896391 |
| Molecular Formula | C31H40N2O4 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-hexyl-N-(3-methoxypropyl)benzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(CCCOC)CC(=O)N(Cc2ccccc2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C31H40N2O4/c1-3-4-5-7-12-26-16-18-28(19-17-26)31(35)32(20-11-21-36-2)25-30(34)33(24-29-15-10-22-37-29)23-27-13-8-6-9-14-27/h6,8-10,13-19,22H,3-5,7,11-12,20-21,23-25H2,1-2H3 |
| InChIKey | XKTFMOQTUIEGJP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|