C26H29FN2O4 — CID 3675725
N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-2-(4-fluorophenyl)-N-(3-methoxypropyl)acetamide (PubChem CID 3675725) has the molecular formula C26H29FN2O4 and a molecular weight of 452.53 g/mol. Its IUPAC name is N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-2-(4-fluorophenyl)-N-(3-methoxypropyl)acetamide.
| Compound Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-2-(4-fluorophenyl)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 3675725 |
| Molecular Formula | C26H29FN2O4 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-2-(4-fluorophenyl)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCN(CC(=O)N(Cc1ccccc1)Cc1ccco1)C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C26H29FN2O4/c1-32-15-6-14-28(25(30)17-21-10-12-23(27)13-11-21)20-26(31)29(19-24-9-5-16-33-24)18-22-7-3-2-4-8-22/h2-5,7-13,16H,6,14-15,17-20H2,1H3 |
| InChIKey | ALUVGHWFYYUBLD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|