C20H27N3O4 — CID 42773023
N-benzyl-2-[dimethylcarbamoyl(2-methoxyethyl)amino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 42773023) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-benzyl-2-[dimethylcarbamoyl(2-methoxyethyl)amino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[dimethylcarbamoyl(2-methoxyethyl)amino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 42773023 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-benzyl-2-[dimethylcarbamoyl(2-methoxyethyl)amino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | COCCN(CC(=O)N(Cc1ccccc1)Cc1ccco1)C(=O)N(C)C |
| InChI | InChI=1S/C20H27N3O4/c1-21(2)20(25)22(11-13-26-3)16-19(24)23(15-18-10-7-12-27-18)14-17-8-5-4-6-9-17/h4-10,12H,11,13-16H2,1-3H3 |
| InChIKey | IFUSFTJHVKVBEZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |