C20H25ClN2O4 — CID 4518262
N-benzyl-2-[(2-chloroacetyl)-(3-methoxypropyl)amino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 4518262) has the molecular formula C20H25ClN2O4 and a molecular weight of 392.88 g/mol. Its IUPAC name is N-benzyl-2-[(2-chloroacetyl)-(3-methoxypropyl)amino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[(2-chloroacetyl)-(3-methoxypropyl)amino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4518262 |
| Molecular Formula | C20H25ClN2O4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-benzyl-2-[(2-chloroacetyl)-(3-methoxypropyl)amino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | COCCCN(CC(=O)N(Cc1ccccc1)Cc1ccco1)C(=O)CCl |
| InChI | InChI=1S/C20H25ClN2O4/c1-26-11-6-10-22(19(24)13-21)16-20(25)23(15-18-9-5-12-27-18)14-17-7-3-2-4-8-17/h2-5,7-9,12H,6,10-11,13-16H2,1H3 |
| InChIKey | UQJQFGNIHNJHCT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|