C30H33N3O4 — CID 3999522
N-[2-[furan-2-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-4-phenylbenzamide (PubChem CID 3999522) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is N-[2-[furan-2-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-4-phenylbenzamide.
| Compound Name | N-[2-[furan-2-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 3999522 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | N-[2-[furan-2-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-4-phenylbenzamide |
| SMILES | COCCCN(CC(=O)N(Cc1ccco1)Cc1cccn1C)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H33N3O4/c1-31-17-6-11-27(31)21-33(22-28-12-7-20-37-28)29(34)23-32(18-8-19-36-2)30(35)26-15-13-25(14-16-26)24-9-4-3-5-10-24/h3-7,9-17,20H,8,18-19,21-23H2,1-2H3 |
| InChIKey | VGAKUFQKIVZESB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 67.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|