C24H28ClN3O4 — CID 4039810
3-chloro-N-[2-[furan-2-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide (PubChem CID 4039810) has the molecular formula C24H28ClN3O4 and a molecular weight of 457.96 g/mol. Its IUPAC name is 3-chloro-N-[2-[furan-2-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-chloro-N-[2-[furan-2-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 4039810 |
| Molecular Formula | C24H28ClN3O4 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 3-chloro-N-[2-[furan-2-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CC(=O)N(Cc1ccco1)Cc1cccn1C)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H28ClN3O4/c1-26-11-4-9-21(26)16-28(17-22-10-5-14-32-22)23(29)18-27(12-6-13-31-2)24(30)19-7-3-8-20(25)15-19/h3-5,7-11,14-15H,6,12-13,16-18H2,1-2H3 |
| InChIKey | NYTIKABGWXKWDH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|