C28H33ClN2O6 — CID 5238005
3-chloro-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide (PubChem CID 5238005) has the molecular formula C28H33ClN2O6 and a molecular weight of 529.03 g/mol. Its IUPAC name is 3-chloro-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-chloro-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 5238005 |
| Molecular Formula | C28H33ClN2O6 |
| Molecular Weight | 529.03 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 3-chloro-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1ccco1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C28H33ClN2O6/c1-34-15-6-13-31(28(33)22-7-4-8-23(29)18-22)20-27(32)30(19-24-9-5-16-37-24)14-12-21-10-11-25(35-2)26(17-21)36-3/h4-5,7-11,16-18H,6,12-15,19-20H2,1-3H3 |
| InChIKey | HIMANRGTZQUCSP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.03 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|