C30H38N2O6 — CID 3911121
N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-4-ethyl-N-(3-methoxypropyl)benzamide (PubChem CID 3911121) has the molecular formula C30H38N2O6 and a molecular weight of 522.64 g/mol. Its IUPAC name is N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-4-ethyl-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-4-ethyl-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 3911121 |
| Molecular Formula | C30H38N2O6 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-4-ethyl-N-(3-methoxypropyl)benzamide |
| SMILES | CCc1ccc(C(=O)N(CCCOC)CC(=O)N(CCc2ccc(OC)c(OC)c2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C30H38N2O6/c1-5-23-9-12-25(13-10-23)30(34)32(16-7-18-35-2)22-29(33)31(21-26-8-6-19-38-26)17-15-24-11-14-27(36-3)28(20-24)37-4/h6,8-14,19-20H,5,7,15-18,21-22H2,1-4H3 |
| InChIKey | HQOHHOZMIAOHDW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|