C22H32N2O7S — CID 42773209
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(furan-2-ylmethyl)-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide (PubChem CID 42773209) has the molecular formula C22H32N2O7S and a molecular weight of 468.57 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(furan-2-ylmethyl)-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(furan-2-ylmethyl)-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 42773209 |
| Molecular Formula | C22H32N2O7S |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(furan-2-ylmethyl)-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide |
| SMILES | COCCCN(CC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1ccco1)S(C)(=O)=O |
| InChI | InChI=1S/C22H32N2O7S/c1-28-13-6-11-24(32(4,26)27)17-22(25)23(16-19-7-5-14-31-19)12-10-18-8-9-20(29-2)21(15-18)30-3/h5,7-9,14-15H,6,10-13,16-17H2,1-4H3 |
| InChIKey | FNRBUEOWGHBXAY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|