C33H44N2O5 — CID 4297034
N-butan-2-yl-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-4-pentylbenzamide (PubChem CID 4297034) has the molecular formula C33H44N2O5 and a molecular weight of 548.72 g/mol. Its IUPAC name is N-butan-2-yl-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-4-pentylbenzamide.
| Compound Name | N-butan-2-yl-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 4297034 |
| Molecular Formula | C33H44N2O5 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | N-butan-2-yl-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)N(CC(=O)N(CCc2ccc(OC)c(OC)c2)Cc2ccco2)C(C)CC)cc1 |
| InChI | InChI=1S/C33H44N2O5/c1-6-8-9-11-26-13-16-28(17-14-26)33(37)35(25(3)7-2)24-32(36)34(23-29-12-10-21-40-29)20-19-27-15-18-30(38-4)31(22-27)39-5/h10,12-18,21-22,25H,6-9,11,19-20,23-24H2,1-5H3 |
| InChIKey | BGGXKRCZVBSWKB-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|