C30H38N2O3 — CID 5123105
N-butan-2-yl-4-butyl-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]benzamide (PubChem CID 5123105) has the molecular formula C30H38N2O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is N-butan-2-yl-4-butyl-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]benzamide.
| Compound Name | N-butan-2-yl-4-butyl-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 5123105 |
| Molecular Formula | C30H38N2O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | N-butan-2-yl-4-butyl-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]benzamide |
| SMILES | CCCCc1ccc(C(=O)N(CC(=O)N(CCc2ccccc2)Cc2ccco2)C(C)CC)cc1 |
| InChI | InChI=1S/C30H38N2O3/c1-4-6-11-26-15-17-27(18-16-26)30(34)32(24(3)5-2)23-29(33)31(22-28-14-10-21-35-28)20-19-25-12-8-7-9-13-25/h7-10,12-18,21,24H,4-6,11,19-20,22-23H2,1-3H3 |
| InChIKey | KSBWNYZJXAFUSG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |