C21H27ClN2O3 — CID 93109685
2-[[(2S)-butan-2-yl]-(2-chloroacetyl)amino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide (PubChem CID 93109685) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is 2-[[(2S)-butan-2-yl]-(2-chloroacetyl)amino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[[(2S)-butan-2-yl]-(2-chloroacetyl)amino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 93109685 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-[[(2S)-butan-2-yl]-(2-chloroacetyl)amino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide |
| SMILES | CC[C@H](C)N(CC(=O)N(CCc1ccccc1)Cc1ccco1)C(=O)CCl |
| InChI | InChI=1S/C21H27ClN2O3/c1-3-17(2)24(20(25)14-22)16-21(26)23(15-19-10-7-13-27-19)12-11-18-8-5-4-6-9-18/h4-10,13,17H,3,11-12,14-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | XWEZBOJBLDXXSP-KRWDZBQOSA-N |
| XLogP | 3.72 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|