C26H30FN3O3 — CID 4259717
N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-fluoro-N-(3-methoxypropyl)benzamide (PubChem CID 4259717) has the molecular formula C26H30FN3O3 and a molecular weight of 451.54 g/mol. Its IUPAC name is N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-fluoro-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-fluoro-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 4259717 |
| Molecular Formula | C26H30FN3O3 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-fluoro-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CC(=O)N(Cc1ccccc1)Cc1cccn1C)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C26H30FN3O3/c1-28-14-7-13-24(28)19-30(18-21-9-4-3-5-10-21)25(31)20-29(15-8-16-33-2)26(32)22-11-6-12-23(27)17-22/h3-7,9-14,17H,8,15-16,18-20H2,1-2H3 |
| InChIKey | CEHMKOWIDCCJEO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|