C27H33N3O3 — CID 4042213
N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-butyl-3-methoxybenzamide (PubChem CID 4042213) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-butyl-3-methoxybenzamide.
| Compound Name | N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-butyl-3-methoxybenzamide |
|---|---|
| PubChem CID | 4042213 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-butyl-3-methoxybenzamide |
| SMILES | CCCCN(CC(=O)N(Cc1ccccc1)Cc1cccn1C)C(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C27H33N3O3/c1-4-5-17-29(27(32)23-13-9-15-25(18-23)33-3)21-26(31)30(19-22-11-7-6-8-12-22)20-24-14-10-16-28(24)2/h6-16,18H,4-5,17,19-21H2,1-3H3 |
| InChIKey | PZRWJVRYJARRFN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |