C23H32BrN3O3 — CID 3985502
3-bromo-N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide (PubChem CID 3985502) has the molecular formula C23H32BrN3O3 and a molecular weight of 478.43 g/mol. Its IUPAC name is 3-bromo-N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-bromo-N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 3985502 |
| Molecular Formula | C23H32BrN3O3 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 3-bromo-N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
| SMILES | CCCCN(Cc1cccn1C)C(=O)CN(CCCOC)C(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C23H32BrN3O3/c1-4-5-13-26(17-21-11-7-12-25(21)2)22(28)18-27(14-8-15-30-3)23(29)19-9-6-10-20(24)16-19/h6-7,9-12,16H,4-5,8,13-15,17-18H2,1-3H3 |
| InChIKey | CEVIMCNQEHDIDC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|