C22H28BrN3O3 — CID 4043231
3-bromo-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide (PubChem CID 4043231) has the molecular formula C22H28BrN3O3 and a molecular weight of 462.39 g/mol. Its IUPAC name is 3-bromo-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-bromo-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 4043231 |
| Molecular Formula | C22H28BrN3O3 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 3-bromo-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CC(=O)N(Cc1cccn1C)C1CC1)C(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C22H28BrN3O3/c1-24-11-4-8-20(24)15-26(19-9-10-19)21(27)16-25(12-5-13-29-2)22(28)17-6-3-7-18(23)14-17/h3-4,6-8,11,14,19H,5,9-10,12-13,15-16H2,1-2H3 |
| InChIKey | DMYKEIXNMAGOTI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|