C24H33N3O2 — CID 3473022
N-butyl-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-ethylbenzamide (PubChem CID 3473022) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-butyl-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-ethylbenzamide.
| Compound Name | N-butyl-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 3473022 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-butyl-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-ethylbenzamide |
| SMILES | CCCCN(CC(=O)N(Cc1cccn1C)C1CC1)C(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C24H33N3O2/c1-4-6-16-26(24(29)20-11-9-19(5-2)10-12-20)18-23(28)27(21-13-14-21)17-22-8-7-15-25(22)3/h7-12,15,21H,4-6,13-14,16-18H2,1-3H3 |
| InChIKey | RQBWXQVZDLSSER-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |