C18H28ClN3O3 — CID 7216924
(2R)-2-chloro-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)propanamide (PubChem CID 7216924) has the molecular formula C18H28ClN3O3 and a molecular weight of 369.89 g/mol. Its IUPAC name is (2R)-2-chloro-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)propanamide.
| Compound Name | (2R)-2-chloro-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 7216924 |
| Molecular Formula | C18H28ClN3O3 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (2R)-2-chloro-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCN(CC(=O)N(Cc1cccn1C)C1CC1)C(=O)[C@@H](C)Cl |
| InChI | InChI=1S/C18H28ClN3O3/c1-14(19)18(24)21(10-5-11-25-3)13-17(23)22(15-7-8-15)12-16-6-4-9-20(16)2/h4,6,9,14-15H,5,7-8,10-13H2,1-3H3/t14-/m1/s1 |
| InChIKey | MMVRFNVMDRONBX-CQSZACIVSA-N |
| XLogP | 2.01 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|