C20H34ClN3O3 — CID 7348081
(2R)-N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-2-chloro-N-(3-ethoxypropyl)propanamide (PubChem CID 7348081) has the molecular formula C20H34ClN3O3 and a molecular weight of 399.96 g/mol. Its IUPAC name is (2R)-N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-2-chloro-N-(3-ethoxypropyl)propanamide.
| Compound Name | (2R)-N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-2-chloro-N-(3-ethoxypropyl)propanamide |
|---|---|
| PubChem CID | 7348081 |
| Molecular Formula | C20H34ClN3O3 |
| Molecular Weight | 399.96 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | (2R)-N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-2-chloro-N-(3-ethoxypropyl)propanamide |
| SMILES | CCCCN(Cc1cccn1C)C(=O)CN(CCCOCC)C(=O)[C@@H](C)Cl |
| InChI | InChI=1S/C20H34ClN3O3/c1-5-7-12-23(15-18-10-8-11-22(18)4)19(25)16-24(20(26)17(3)21)13-9-14-27-6-2/h8,10-11,17H,5-7,9,12-16H2,1-4H3/t17-/m1/s1 |
| InChIKey | FLORRAFZBRWVCO-QGZVFWFLSA-N |
| XLogP | 3.04 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.96 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|