C24H34N4O5 — CID 3505125
N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-3-nitrobenzamide (PubChem CID 3505125) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-3-nitrobenzamide.
| Compound Name | N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 3505125 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-3-nitrobenzamide |
| SMILES | CCCCN(Cc1cccn1C)C(=O)CN(CCCOCC)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H34N4O5/c1-4-6-14-26(18-22-12-8-13-25(22)3)23(29)19-27(15-9-16-33-5-2)24(30)20-10-7-11-21(17-20)28(31)32/h7-8,10-13,17H,4-6,9,14-16,18-19H2,1-3H3 |
| InChIKey | ZPBMVGSWPTUMGE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 97.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|