C23H32N4O4 — CID 3885493
N-butyl-N-[2-[2-methylpropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 3885493) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-butyl-N-[2-[2-methylpropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-butyl-N-[2-[2-methylpropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3885493 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | N-butyl-N-[2-[2-methylpropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | CCCCN(CC(=O)N(Cc1cccn1C)CC(C)C)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H32N4O4/c1-5-6-13-25(23(29)19-9-7-10-20(14-19)27(30)31)17-22(28)26(15-18(2)3)16-21-11-8-12-24(21)4/h7-12,14,18H,5-6,13,15-17H2,1-4H3 |
| InChIKey | TZTCLGVETLCLGW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|