C19H34N4O2 — CID 3601596
2-[butyl(ethylcarbamoyl)amino]-N-(2-methylpropyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide (PubChem CID 3601596) has the molecular formula C19H34N4O2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-[butyl(ethylcarbamoyl)amino]-N-(2-methylpropyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide.
| Compound Name | 2-[butyl(ethylcarbamoyl)amino]-N-(2-methylpropyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3601596 |
| Molecular Formula | C19H34N4O2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 2-[butyl(ethylcarbamoyl)amino]-N-(2-methylpropyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
| SMILES | CCCCN(CC(=O)N(Cc1cccn1C)CC(C)C)C(=O)NCC |
| InChI | InChI=1S/C19H34N4O2/c1-6-8-12-22(19(25)20-7-2)15-18(24)23(13-16(3)4)14-17-10-9-11-21(17)5/h9-11,16H,6-8,12-15H2,1-5H3,(H,20,25) |
| InChIKey | FQLFMRVFRGGMJY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |