C22H29ClN4O4 — CID 3992145
N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-2-chloro-4-nitro-N-propylbenzamide (PubChem CID 3992145) has the molecular formula C22H29ClN4O4 and a molecular weight of 448.95 g/mol. Its IUPAC name is N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-2-chloro-4-nitro-N-propylbenzamide.
| Compound Name | N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-2-chloro-4-nitro-N-propylbenzamide |
|---|---|
| PubChem CID | 3992145 |
| Molecular Formula | C22H29ClN4O4 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-2-chloro-4-nitro-N-propylbenzamide |
| SMILES | CCCCN(Cc1cccn1C)C(=O)CN(CCC)C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C22H29ClN4O4/c1-4-6-13-25(15-18-8-7-12-24(18)3)21(28)16-26(11-5-2)22(29)19-10-9-17(27(30)31)14-20(19)23/h7-10,12,14H,4-6,11,13,15-16H2,1-3H3 |
| InChIKey | MTWNTQHOZKNCNU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|