C19H23ClN4O5 — CID 4126821
2-chloro-N-hexyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-4-nitrobenzamide (PubChem CID 4126821) has the molecular formula C19H23ClN4O5 and a molecular weight of 422.87 g/mol. Its IUPAC name is 2-chloro-N-hexyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-hexyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4126821 |
| Molecular Formula | C19H23ClN4O5 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-chloro-N-hexyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-4-nitrobenzamide |
| SMILES | CCCCCCN(CC(=O)Nc1cc(C)on1)C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H23ClN4O5/c1-3-4-5-6-9-23(12-18(25)21-17-10-13(2)29-22-17)19(26)15-8-7-14(24(27)28)11-16(15)20/h7-8,10-11H,3-6,9,12H2,1-2H3,(H,21,22,25) |
| InChIKey | IZKRHGYZDNMBCZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|