C18H21ClN4O5 — CID 42769043
2-chloro-N-hexyl-4-nitro-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide (PubChem CID 42769043) has the molecular formula C18H21ClN4O5 and a molecular weight of 408.84 g/mol. Its IUPAC name is 2-chloro-N-hexyl-4-nitro-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide.
| Compound Name | 2-chloro-N-hexyl-4-nitro-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 42769043 |
| Molecular Formula | C18H21ClN4O5 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-chloro-N-hexyl-4-nitro-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide |
| SMILES | CCCCCCN(CC(=O)Nc1ccon1)C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C18H21ClN4O5/c1-2-3-4-5-9-22(12-17(24)20-16-8-10-28-21-16)18(25)14-7-6-13(23(26)27)11-15(14)19/h6-8,10-11H,2-5,9,12H2,1H3,(H,20,21,24) |
| InChIKey | JXVVYOIQHIZYDB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|