C19H29ClN2O3 — CID 4082207
2-chloro-N,N-dihexyl-4-nitrobenzamide (PubChem CID 4082207) has the molecular formula C19H29ClN2O3 and a molecular weight of 368.91 g/mol. Its IUPAC name is 2-chloro-N,N-dihexyl-4-nitrobenzamide.
| Compound Name | 2-chloro-N,N-dihexyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 4082207 |
| Molecular Formula | C19H29ClN2O3 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2-chloro-N,N-dihexyl-4-nitrobenzamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H29ClN2O3/c1-3-5-7-9-13-21(14-10-8-6-4-2)19(23)17-12-11-16(22(24)25)15-18(17)20/h11-12,15H,3-10,13-14H2,1-2H3 |
| InChIKey | HYGTVVPIURJNGR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|