C11H13ClN2O5 — CID 60653170
2-chloro-N,N-bis(2-hydroxyethyl)-4-nitrobenzamide (PubChem CID 60653170) has the molecular formula C11H13ClN2O5 and a molecular weight of 288.69 g/mol. Its IUPAC name is 2-chloro-N,N-bis(2-hydroxyethyl)-4-nitrobenzamide.
| Compound Name | 2-chloro-N,N-bis(2-hydroxyethyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 60653170 |
| Molecular Formula | C11H13ClN2O5 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-chloro-N,N-bis(2-hydroxyethyl)-4-nitrobenzamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1Cl)N(CCO)CCO |
| InChI | InChI=1S/C11H13ClN2O5/c12-10-7-8(14(18)19)1-2-9(10)11(17)13(3-5-15)4-6-16/h1-2,7,15-16H,3-6H2 |
| InChIKey | OHSHFCPTNMTBJA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|