C11H7ClN4O3 — CID 796594
2-chloro-N,N-bis(cyanomethyl)-4-nitrobenzamide (PubChem CID 796594) has the molecular formula C11H7ClN4O3 and a molecular weight of 278.66 g/mol. Its IUPAC name is 2-chloro-N,N-bis(cyanomethyl)-4-nitrobenzamide.
| Compound Name | 2-chloro-N,N-bis(cyanomethyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 796594 |
| Molecular Formula | C11H7ClN4O3 |
| Molecular Weight | 278.66 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 2-chloro-N,N-bis(cyanomethyl)-4-nitrobenzamide |
| SMILES | N#CCN(CC#N)C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H7ClN4O3/c12-10-7-8(16(18)19)1-2-9(10)11(17)15(5-3-13)6-4-14/h1-2,7H,5-6H2 |
| InChIKey | PEYPNMJENSGFOO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 111.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.66 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|