About potassium 2-chloro-4-nitrobenzoic acid
potassium 2-chloro-4-nitrobenzoic acid (PubChem CID 23673793) has the molecular formula C7H4ClKNO4+
and a molecular weight of 240.66 g/mol. Its IUPAC name is potassium 2-chloro-4-nitrobenzoic acid.
Molecular Properties
| Compound Name | potassium 2-chloro-4-nitrobenzoic acid |
| PubChem CID | 23673793 |
| Molecular Formula | C7H4ClKNO4+ |
| Molecular Weight | 240.66 g/mol |
| Exact Mass | 239.95 |
| IUPAC Name | potassium 2-chloro-4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1Cl.[K+] |
| InChI | InChI=1S/C7H4ClNO4.K/c8-6-3-4(9(12)13)1-2-5(6)7(10)11;/h1-3H,(H,10,11);/q;+1 |
| InChIKey | RFOMKRIDPCCWRA-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.66 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium 2-chloro-4-nitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-chloro-4-nitrobenzoic acid?
The IUPAC name of potassium 2-chloro-4-nitrobenzoic acid (CID 23673793) is potassium 2-chloro-4-nitrobenzoic acid.
What is the SMILES notation for potassium 2-chloro-4-nitrobenzoic acid?
The canonical SMILES for potassium 2-chloro-4-nitrobenzoic acid is O=C(O)c1ccc([N+](=O)[O-])cc1Cl.[K+].
What is the InChIKey of potassium 2-chloro-4-nitrobenzoic acid?
The InChIKey is RFOMKRIDPCCWRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClNO4.K/c8-6-3-4(9(12)13)1-2-5(6)7(10)11;/h1-3H,(H,10,11);/q;+1.
What are the key properties of potassium 2-chloro-4-nitrobenzoic acid?
potassium 2-chloro-4-nitrobenzoic acid has a molecular weight of 240.66 g/mol, XLogP of -1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-chloro-4-nitrobenzoic acid is sourced from PubChem (CID 23673793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).