About 2-cyano-4-nitrobenzoic acid
2-cyano-4-nitrobenzoic acid (PubChem CID 14468708) has the molecular formula C8H4N2O4
and a molecular weight of 192.13 g/mol. Its IUPAC name is 2-cyano-4-nitrobenzoic acid.
Molecular Properties
| Compound Name | 2-cyano-4-nitrobenzoic acid |
| PubChem CID | 14468708 |
| Molecular Formula | C8H4N2O4 |
| Molecular Weight | 192.13 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 2-cyano-4-nitrobenzoic acid |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1C(=O)O |
| InChI | InChI=1S/C8H4N2O4/c9-4-5-3-6(10(13)14)1-2-7(5)8(11)12/h1-3H,(H,11,12) |
| InChIKey | BLNXTHLTJNAHOI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.13 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-4-nitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-4-nitrobenzoic acid?
The IUPAC name of 2-cyano-4-nitrobenzoic acid (CID 14468708) is 2-cyano-4-nitrobenzoic acid.
What is the SMILES notation for 2-cyano-4-nitrobenzoic acid?
The canonical SMILES for 2-cyano-4-nitrobenzoic acid is N#Cc1cc([N+](=O)[O-])ccc1C(=O)O.
What is the InChIKey of 2-cyano-4-nitrobenzoic acid?
The InChIKey is BLNXTHLTJNAHOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O4/c9-4-5-3-6(10(13)14)1-2-7(5)8(11)12/h1-3H,(H,11,12).
What are the key properties of 2-cyano-4-nitrobenzoic acid?
2-cyano-4-nitrobenzoic acid has a molecular weight of 192.13 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-4-nitrobenzoic acid is sourced from PubChem (CID 14468708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).