2-cyano-4-nitrobenzoic acid

C8H4N2O4 — CID 14468708

IUPAC2-cyano-4-nitrobenzoic acid
SMILESN#Cc1cc([N+](=O)[O-])ccc1C(=O)O
InChIInChI=1S/C8H4N2O4/c9-4-5-3-6(10(13)14)1-2-7(5)8(11)12/h1-3H,(H,11,12)
InChIKeyBLNXTHLTJNAHOI-UHFFFAOYSA-N
MW192.13 g/mol
LogP1.16
Rot. Bonds2

About 2-cyano-4-nitrobenzoic acid

2-cyano-4-nitrobenzoic acid (PubChem CID 14468708) has the molecular formula C8H4N2O4 and a molecular weight of 192.13 g/mol. Its IUPAC name is 2-cyano-4-nitrobenzoic acid.

Molecular Properties

Compound Name2-cyano-4-nitrobenzoic acid
PubChem CID14468708
Molecular FormulaC8H4N2O4
Molecular Weight192.13 g/mol
Exact Mass192.02
IUPAC Name2-cyano-4-nitrobenzoic acid
SMILESN#Cc1cc([N+](=O)[O-])ccc1C(=O)O
InChIInChI=1S/C8H4N2O4/c9-4-5-3-6(10(13)14)1-2-7(5)8(11)12/h1-3H,(H,11,12)
InChIKeyBLNXTHLTJNAHOI-UHFFFAOYSA-N
XLogP1.16
TPSA104.23 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.13
LogP ≤ 51.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-cyano-4-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyano-4-nitrobenzoic acid?
The IUPAC name of 2-cyano-4-nitrobenzoic acid (CID 14468708) is 2-cyano-4-nitrobenzoic acid.
What is the SMILES notation for 2-cyano-4-nitrobenzoic acid?
The canonical SMILES for 2-cyano-4-nitrobenzoic acid is N#Cc1cc([N+](=O)[O-])ccc1C(=O)O.
What is the InChIKey of 2-cyano-4-nitrobenzoic acid?
The InChIKey is BLNXTHLTJNAHOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O4/c9-4-5-3-6(10(13)14)1-2-7(5)8(11)12/h1-3H,(H,11,12).
What are the key properties of 2-cyano-4-nitrobenzoic acid?
2-cyano-4-nitrobenzoic acid has a molecular weight of 192.13 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-4-nitrobenzoic acid is sourced from PubChem (CID 14468708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).