About 2-cyano-4-nitrophenolate
2-cyano-4-nitrophenolate (PubChem CID 15373227) has the molecular formula C7H3N2O3-
and a molecular weight of 163.11 g/mol. Its IUPAC name is 2-cyano-4-nitrophenolate.
Molecular Properties
| Compound Name | 2-cyano-4-nitrophenolate |
| PubChem CID | 15373227 |
| Molecular Formula | C7H3N2O3- |
| Molecular Weight | 163.11 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | 2-cyano-4-nitrophenolate |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C7H4N2O3/c8-4-5-3-6(9(11)12)1-2-7(5)10/h1-3,10H/p-1 |
| InChIKey | MPQNPFJBRPRBFF-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 89.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.11 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-4-nitrophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-4-nitrophenolate?
The IUPAC name of 2-cyano-4-nitrophenolate (CID 15373227) is 2-cyano-4-nitrophenolate.
What is the SMILES notation for 2-cyano-4-nitrophenolate?
The canonical SMILES for 2-cyano-4-nitrophenolate is N#Cc1cc([N+](=O)[O-])ccc1[O-].
What is the InChIKey of 2-cyano-4-nitrophenolate?
The InChIKey is MPQNPFJBRPRBFF-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H4N2O3/c8-4-5-3-6(9(11)12)1-2-7(5)10/h1-3,10H/p-1.
What are the key properties of 2-cyano-4-nitrophenolate?
2-cyano-4-nitrophenolate has a molecular weight of 163.11 g/mol, XLogP of 0.54, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-4-nitrophenolate is sourced from PubChem (CID 15373227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).