About bis(4-nitrophthalic acid);zirconium
bis(4-nitrophthalic acid);zirconium (PubChem CID 5176883) has the molecular formula C16H10N2O12Zr
and a molecular weight of 513.48 g/mol. Its IUPAC name is bis(4-nitrophthalic acid);zirconium.
Molecular Properties
| Compound Name | bis(4-nitrophthalic acid);zirconium |
| PubChem CID | 5176883 |
| Molecular Formula | C16H10N2O12Zr |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 511.93 |
| IUPAC Name | bis(4-nitrophthalic acid);zirconium |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)O.O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)O.[Zr] |
| InChI | InChI=1S/2C8H5NO6.Zr/c2*10-7(11)5-2-1-4(9(14)15)3-6(5)8(12)13;/h2*1-3H,(H,10,11)(H,12,13); |
| InChIKey | RYCWSCXSKVPFIM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 235.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(4-nitrophthalic acid);zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-nitrophthalic acid);zirconium?
The IUPAC name of bis(4-nitrophthalic acid);zirconium (CID 5176883) is bis(4-nitrophthalic acid);zirconium.
What is the SMILES notation for bis(4-nitrophthalic acid);zirconium?
The canonical SMILES for bis(4-nitrophthalic acid);zirconium is O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)O.O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)O.[Zr].
What is the InChIKey of bis(4-nitrophthalic acid);zirconium?
The InChIKey is RYCWSCXSKVPFIM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H5NO6.Zr/c2*10-7(11)5-2-1-4(9(14)15)3-6(5)8(12)13;/h2*1-3H,(H,10,11)(H,12,13);.
What are the key properties of bis(4-nitrophthalic acid);zirconium?
bis(4-nitrophthalic acid);zirconium has a molecular weight of 513.48 g/mol, XLogP of 1.98, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-nitrophthalic acid);zirconium is sourced from PubChem (CID 5176883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).