About potassium 2-chloro-4-nitrophenol
potassium 2-chloro-4-nitrophenol (PubChem CID 71150199) has the molecular formula C6H4ClKNO3+
and a molecular weight of 212.65 g/mol. Its IUPAC name is potassium 2-chloro-4-nitrophenol.
Molecular Properties
| Compound Name | potassium 2-chloro-4-nitrophenol |
| PubChem CID | 71150199 |
| Molecular Formula | C6H4ClKNO3+ |
| Molecular Weight | 212.65 g/mol |
| Exact Mass | 211.95 |
| IUPAC Name | potassium 2-chloro-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(Cl)c1.[K+] |
| InChI | InChI=1S/C6H4ClNO3.K/c7-5-3-4(8(10)11)1-2-6(5)9;/h1-3,9H;/q;+1 |
| InChIKey | ZQYQLWUIWFVNQN-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.65 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium 2-chloro-4-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-chloro-4-nitrophenol?
The IUPAC name of potassium 2-chloro-4-nitrophenol (CID 71150199) is potassium 2-chloro-4-nitrophenol.
What is the SMILES notation for potassium 2-chloro-4-nitrophenol?
The canonical SMILES for potassium 2-chloro-4-nitrophenol is O=[N+]([O-])c1ccc(O)c(Cl)c1.[K+].
What is the InChIKey of potassium 2-chloro-4-nitrophenol?
The InChIKey is ZQYQLWUIWFVNQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO3.K/c7-5-3-4(8(10)11)1-2-6(5)9;/h1-3,9H;/q;+1.
What are the key properties of potassium 2-chloro-4-nitrophenol?
potassium 2-chloro-4-nitrophenol has a molecular weight of 212.65 g/mol, XLogP of -1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-chloro-4-nitrophenol is sourced from PubChem (CID 71150199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).