C12H5Cl5N2O4 — CID 155677930
1,2-dichloro-4-nitrobenzene;1,2,3-trichloro-5-nitrobenzene (PubChem CID 155677930) has the molecular formula C12H5Cl5N2O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 1,2-dichloro-4-nitrobenzene;1,2,3-trichloro-5-nitrobenzene.
| Compound Name | 1,2-dichloro-4-nitrobenzene;1,2,3-trichloro-5-nitrobenzene |
|---|---|
| PubChem CID | 155677930 |
| Molecular Formula | C12H5Cl5N2O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 415.87 |
| IUPAC Name | 1,2-dichloro-4-nitrobenzene;1,2,3-trichloro-5-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)c(Cl)c1.O=[N+]([O-])c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H2Cl3NO2.C6H3Cl2NO2/c7-4-1-3(10(11)12)2-5(8)6(4)9;7-5-2-1-4(9(10)11)3-6(5)8/h1-2H;1-3H |
| InChIKey | WZGHKPXNOHWSML-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|