C6H4BCl2NO4 — CID 164643631
(2,3-dichloro-5-nitrophenyl)boronic acid (PubChem CID 164643631) has the molecular formula C6H4BCl2NO4 and a molecular weight of 235.82 g/mol. Its IUPAC name is (2,3-dichloro-5-nitrophenyl)boronic acid.
| Compound Name | (2,3-dichloro-5-nitrophenyl)boronic acid |
|---|---|
| PubChem CID | 164643631 |
| Molecular Formula | C6H4BCl2NO4 |
| Molecular Weight | 235.82 g/mol |
| Exact Mass | 234.96 |
| IUPAC Name | (2,3-dichloro-5-nitrophenyl)boronic acid |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)c(B(O)O)c1 |
| InChI | InChI=1S/C6H4BCl2NO4/c8-5-2-3(10(13)14)1-4(6(5)9)7(11)12/h1-2,11-12H |
| InChIKey | MPEXTALKKZRJCM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.82 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|