(2,3-dichloro-5-nitrophenyl)boronic acid

C6H4BCl2NO4 — CID 164643631

IUPAC(2,3-dichloro-5-nitrophenyl)boronic acid
SMILESO=[N+]([O-])c1cc(Cl)c(Cl)c(B(O)O)c1
InChIInChI=1S/C6H4BCl2NO4/c8-5-2-3(10(13)14)1-4(6(5)9)7(11)12/h1-2,11-12H
InChIKeyMPEXTALKKZRJCM-UHFFFAOYSA-N
MW235.82 g/mol
LogP0.58
Rot. Bonds2

About (2,3-dichloro-5-nitrophenyl)boronic acid

(2,3-dichloro-5-nitrophenyl)boronic acid (PubChem CID 164643631) has the molecular formula C6H4BCl2NO4 and a molecular weight of 235.82 g/mol. Its IUPAC name is (2,3-dichloro-5-nitrophenyl)boronic acid.

Molecular Properties

Compound Name(2,3-dichloro-5-nitrophenyl)boronic acid
PubChem CID164643631
Molecular FormulaC6H4BCl2NO4
Molecular Weight235.82 g/mol
Exact Mass234.96
IUPAC Name(2,3-dichloro-5-nitrophenyl)boronic acid
SMILESO=[N+]([O-])c1cc(Cl)c(Cl)c(B(O)O)c1
InChIInChI=1S/C6H4BCl2NO4/c8-5-2-3(10(13)14)1-4(6(5)9)7(11)12/h1-2,11-12H
InChIKeyMPEXTALKKZRJCM-UHFFFAOYSA-N
XLogP0.58
TPSA83.60 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.82
LogP ≤ 50.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2,3-dichloro-5-nitrophenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-dichloro-5-nitrophenyl)boronic acid?
The IUPAC name of (2,3-dichloro-5-nitrophenyl)boronic acid (CID 164643631) is (2,3-dichloro-5-nitrophenyl)boronic acid.
What is the SMILES notation for (2,3-dichloro-5-nitrophenyl)boronic acid?
The canonical SMILES for (2,3-dichloro-5-nitrophenyl)boronic acid is O=[N+]([O-])c1cc(Cl)c(Cl)c(B(O)O)c1.
What is the InChIKey of (2,3-dichloro-5-nitrophenyl)boronic acid?
The InChIKey is MPEXTALKKZRJCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BCl2NO4/c8-5-2-3(10(13)14)1-4(6(5)9)7(11)12/h1-2,11-12H.
What are the key properties of (2,3-dichloro-5-nitrophenyl)boronic acid?
(2,3-dichloro-5-nitrophenyl)boronic acid has a molecular weight of 235.82 g/mol, XLogP of 0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dichloro-5-nitrophenyl)boronic acid is sourced from PubChem (CID 164643631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).