C6H3BCl3NO4 — CID 46738897
(2,3,4-trichloro-5-nitrophenyl)boronic acid (PubChem CID 46738897) has the molecular formula C6H3BCl3NO4 and a molecular weight of 270.26 g/mol. Its IUPAC name is (2,3,4-trichloro-5-nitrophenyl)boronic acid.
| Compound Name | (2,3,4-trichloro-5-nitrophenyl)boronic acid |
|---|---|
| PubChem CID | 46738897 |
| Molecular Formula | C6H3BCl3NO4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 268.92 |
| IUPAC Name | (2,3,4-trichloro-5-nitrophenyl)boronic acid |
| SMILES | O=[N+]([O-])c1cc(B(O)O)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6H3BCl3NO4/c8-4-2(7(12)13)1-3(11(14)15)5(9)6(4)10/h1,12-13H |
| InChIKey | ZUBMJZYQEWYAHH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|