C6HCl3N2O4 — CID 22875
2,3,4-trichloro-1,5-dinitrobenzene (PubChem CID 22875) has the molecular formula C6HCl3N2O4 and a molecular weight of 271.44 g/mol. Its IUPAC name is 2,3,4-trichloro-1,5-dinitrobenzene.
| Compound Name | 2,3,4-trichloro-1,5-dinitrobenzene |
|---|---|
| PubChem CID | 22875 |
| Molecular Formula | C6HCl3N2O4 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 269.90 |
| IUPAC Name | 2,3,4-trichloro-1,5-dinitrobenzene |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6HCl3N2O4/c7-4-2(10(12)13)1-3(11(14)15)5(8)6(4)9/h1H |
| InChIKey | WUMOEIUPWHYXBM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|