4-chloro-3,5-dinitrobenzoyl chloride

C7H2Cl2N2O5 — CID 23451564

IUPAC4-chloro-3,5-dinitrobenzoyl chloride
SMILESO=C(Cl)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1
InChIInChI=1S/C7H2Cl2N2O5/c8-6-4(10(13)14)1-3(7(9)12)2-5(6)11(15)16/h1-2H
InChIKeyXJECLNKDUIATFG-UHFFFAOYSA-N
MW265.01 g/mol
LogP2.54
Rot. Bonds3

About 4-chloro-3,5-dinitrobenzoyl chloride

4-chloro-3,5-dinitrobenzoyl chloride (PubChem CID 23451564) has the molecular formula C7H2Cl2N2O5 and a molecular weight of 265.01 g/mol. Its IUPAC name is 4-chloro-3,5-dinitrobenzoyl chloride.

Molecular Properties

Compound Name4-chloro-3,5-dinitrobenzoyl chloride
PubChem CID23451564
Molecular FormulaC7H2Cl2N2O5
Molecular Weight265.01 g/mol
Exact Mass263.93
IUPAC Name4-chloro-3,5-dinitrobenzoyl chloride
SMILESO=C(Cl)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1
InChIInChI=1S/C7H2Cl2N2O5/c8-6-4(10(13)14)1-3(7(9)12)2-5(6)11(15)16/h1-2H
InChIKeyXJECLNKDUIATFG-UHFFFAOYSA-N
XLogP2.54
TPSA103.35 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.01
LogP ≤ 52.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-chloro-3,5-dinitrobenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-3,5-dinitrobenzoyl chloride?
The IUPAC name of 4-chloro-3,5-dinitrobenzoyl chloride (CID 23451564) is 4-chloro-3,5-dinitrobenzoyl chloride.
What is the SMILES notation for 4-chloro-3,5-dinitrobenzoyl chloride?
The canonical SMILES for 4-chloro-3,5-dinitrobenzoyl chloride is O=C(Cl)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1.
What is the InChIKey of 4-chloro-3,5-dinitrobenzoyl chloride?
The InChIKey is XJECLNKDUIATFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Cl2N2O5/c8-6-4(10(13)14)1-3(7(9)12)2-5(6)11(15)16/h1-2H.
What are the key properties of 4-chloro-3,5-dinitrobenzoyl chloride?
4-chloro-3,5-dinitrobenzoyl chloride has a molecular weight of 265.01 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3,5-dinitrobenzoyl chloride is sourced from PubChem (CID 23451564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).