About 4-chloro-3,5-dinitrobenzoyl chloride
4-chloro-3,5-dinitrobenzoyl chloride (PubChem CID 23451564) has the molecular formula C7H2Cl2N2O5
and a molecular weight of 265.01 g/mol. Its IUPAC name is 4-chloro-3,5-dinitrobenzoyl chloride.
Molecular Properties
| Compound Name | 4-chloro-3,5-dinitrobenzoyl chloride |
| PubChem CID | 23451564 |
| Molecular Formula | C7H2Cl2N2O5 |
| Molecular Weight | 265.01 g/mol |
| Exact Mass | 263.93 |
| IUPAC Name | 4-chloro-3,5-dinitrobenzoyl chloride |
| SMILES | O=C(Cl)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H2Cl2N2O5/c8-6-4(10(13)14)1-3(7(9)12)2-5(6)11(15)16/h1-2H |
| InChIKey | XJECLNKDUIATFG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.01 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3,5-dinitrobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3,5-dinitrobenzoyl chloride?
The IUPAC name of 4-chloro-3,5-dinitrobenzoyl chloride (CID 23451564) is 4-chloro-3,5-dinitrobenzoyl chloride.
What is the SMILES notation for 4-chloro-3,5-dinitrobenzoyl chloride?
The canonical SMILES for 4-chloro-3,5-dinitrobenzoyl chloride is O=C(Cl)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1.
What is the InChIKey of 4-chloro-3,5-dinitrobenzoyl chloride?
The InChIKey is XJECLNKDUIATFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Cl2N2O5/c8-6-4(10(13)14)1-3(7(9)12)2-5(6)11(15)16/h1-2H.
What are the key properties of 4-chloro-3,5-dinitrobenzoyl chloride?
4-chloro-3,5-dinitrobenzoyl chloride has a molecular weight of 265.01 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3,5-dinitrobenzoyl chloride is sourced from PubChem (CID 23451564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).