C7H4ClN3O6 — CID 71370589
4-chloro-N-hydroxy-3,5-dinitrobenzamide (PubChem CID 71370589) has the molecular formula C7H4ClN3O6 and a molecular weight of 261.58 g/mol. Its IUPAC name is 4-chloro-N-hydroxy-3,5-dinitrobenzamide.
| Compound Name | 4-chloro-N-hydroxy-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 71370589 |
| Molecular Formula | C7H4ClN3O6 |
| Molecular Weight | 261.58 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 4-chloro-N-hydroxy-3,5-dinitrobenzamide |
| SMILES | O=C(NO)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H4ClN3O6/c8-6-4(10(14)15)1-3(7(12)9-13)2-5(6)11(16)17/h1-2,13H,(H,9,12) |
| InChIKey | NUENPCXOUNMMKV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.58 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|