C12H6Cl2N4O5 — CID 4549997
4-chloro-N-(2-chloro-3-pyridinyl)-3,5-dinitrobenzamide (PubChem CID 4549997) has the molecular formula C12H6Cl2N4O5 and a molecular weight of 357.11 g/mol. Its IUPAC name is 4-chloro-N-(2-chloro-3-pyridinyl)-3,5-dinitrobenzamide.
| Compound Name | 4-chloro-N-(2-chloro-3-pyridinyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4549997 |
| Molecular Formula | C12H6Cl2N4O5 |
| Molecular Weight | 357.11 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 4-chloro-N-(2-chloro-3-pyridinyl)-3,5-dinitrobenzamide |
| SMILES | O=C(Nc1cccnc1Cl)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H6Cl2N4O5/c13-10-8(17(20)21)4-6(5-9(10)18(22)23)12(19)16-7-2-1-3-15-11(7)14/h1-5H,(H,16,19) |
| InChIKey | LIBSIYOLFHHSDV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.11 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|