C12H6ClF3N2O — CID 63188572
N-(2-chloro-3-pyridinyl)-3,4,5-trifluorobenzamide (PubChem CID 63188572) has the molecular formula C12H6ClF3N2O and a molecular weight of 286.64 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-3,4,5-trifluorobenzamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 63188572 |
| Molecular Formula | C12H6ClF3N2O |
| Molecular Weight | 286.64 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-3,4,5-trifluorobenzamide |
| SMILES | O=C(Nc1cccnc1Cl)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H6ClF3N2O/c13-11-9(2-1-3-17-11)18-12(19)6-4-7(14)10(16)8(15)5-6/h1-5H,(H,18,19) |
| InChIKey | KIZKTQSWYDEFJB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|