C13H7ClIN3O5 — CID 4629817
4-chloro-N-(2-iodophenyl)-3,5-dinitrobenzamide (PubChem CID 4629817) has the molecular formula C13H7ClIN3O5 and a molecular weight of 447.57 g/mol. Its IUPAC name is 4-chloro-N-(2-iodophenyl)-3,5-dinitrobenzamide.
| Compound Name | 4-chloro-N-(2-iodophenyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4629817 |
| Molecular Formula | C13H7ClIN3O5 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 446.91 |
| IUPAC Name | 4-chloro-N-(2-iodophenyl)-3,5-dinitrobenzamide |
| SMILES | O=C(Nc1ccccc1I)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H7ClIN3O5/c14-12-10(17(20)21)5-7(6-11(12)18(22)23)13(19)16-9-4-2-1-3-8(9)15/h1-6H,(H,16,19) |
| InChIKey | VAZSDZHZCJUYEB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|